EmmaSwan123456789 EmmaSwan123456789

01-11-2016
History

contestada

What is the significance of the date 1787?

Respuesta :

skycow5654 skycow5654

01-11-2016

constitution was submitted to the states for ratification
shays rebellion falls
constitutional convention opens in Philadelphia George Washington presiding

Answer Link

Otras preguntas

Solve for y. [tex] 3y-12=-6 [/tex]

why is a memoir an appropriate text structure for rosa parks to use to share her personal experience of a historical event

how do the large and small intestine differ in appearance? Why might they be so different?

Describe the effect of the French and Indian war

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

When people are in a group situation in which they feel deindividuated, they are most likely to behave badly when ____?

When muscles are contracting under oxygen deficient conditions, they will form ________ to ensure they maintain a supply of atp?

Which audience would this passage be most appropriate for? Novels, poetry, and drama are all parts of literature. These genres of writing often reveal important

many soldiers who fought in the battle of Antietam saw it as a defeat for both armies. why?

Through the first half of the eighteenth century, the iroquois confederacy formed agreements and traded with